CAS 1312937-40-8 appears in our catalog under these names: 4-Methoxy-6,7-quinazolinediol, 95%, 4–Methoxyquinazoline–6,7–diol, 4-Methoxyquinazoline-6,7-diol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-methoxyquinazoline-6,7-diol (CAS 1312937-40-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 4-methoxyquinazoline-6,7-diol. InChIKey: WJRJMGINHRAKFU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-methoxyquinazoline-6,7-diol |
| InChIKey | WJRJMGINHRAKFU-UHFFFAOYSA-N |
| SMILES | COC1=NC=NC2=CC(=C(C=C21)O)O |
Computed by PubChem (NCBI)