CAS 61948-86-5 appears in our catalog under these names: 5-Methoxyquinazoline-2,4(1h,3h)-dione, 98%, 5-Methoxyquinazoline-2,4(1H,3H)-dione 98%, 5-Methoxyquinazoline-2,4(1H,3H)-dione, 97%, 5-Methoxyquinazoline-2,4(1H,3H)-Dione, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
5-methoxy-1H-quinazoline-2,4-dione (CAS 61948-86-5) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-methoxy-1H-quinazoline-2,4-dione. InChIKey: MRZRYTQAWAFKOC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-methoxy-1H-quinazoline-2,4-dione |
| InChIKey | MRZRYTQAWAFKOC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)