cas: 1235666-16-6 — see every product listed under this CAS number, including other names
Methyl 2-pivalamidoisonicotinate 95+% (CAS 1235666-16-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102782-5g |
| cas | 1235666-16-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 1210.31 Pln | |
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 353.69 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A102782 |
Methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate (CAS 1235666-16-6) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate. InChIKey: VIINVAGIQKVNOV-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate |
| InChIKey | VIINVAGIQKVNOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)C(=O)OC |
Computed by PubChem (NCBI)