Products 1915004-58-8

CAS 1915004-58-8 appears in our catalog under these names: Methyl 3,3-dimethylpiperidine-4-carboxylate hydrochloride, 97%, 97%, METHYL 3,3-DIMETHYLPIPERIDINE-4-CARBOXYLATE HCL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3,3-dimethylpiperidine-4-carboxylate;hydrochloride (CAS 1915004-58-8) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl 3,3-dimethylpiperidine-4-carboxylate;hydrochloride. InChIKey: DDGNULFBXWLPLT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC namemethyl 3,3-dimethylpiperidine-4-carboxylate;hydrochloride
InChIKeyDDGNULFBXWLPLT-UHFFFAOYSA-N
SMILESCC1(CNCCC1C(=O)OC)C.Cl

Computed by PubChem (NCBI)