Products 5463-76-3

CAS 5463-76-3 appears in our catalog under these names: 4-(Piperidin-1-yl)butanoic acid hydrochloride, 95%, Piperidin-1-ylbutanoic acid hydrochloride, 4-(Piperidin-1-yl)butanoic acid hydrochloride 95%, 4-(Piperidin-1-yl)butanoic acid hydrochloride, 95%, 95%, 4-Piperidin-1-yl-butyric acid hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 5g, 1g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-piperidin-1-ylbutanoic acid;hydrochloride (CAS 5463-76-3) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: 4-piperidin-1-ylbutanoic acid;hydrochloride. InChIKey: IZVIJYFRXDQEOR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC name4-piperidin-1-ylbutanoic acid;hydrochloride
InChIKeyIZVIJYFRXDQEOR-UHFFFAOYSA-N
SMILESC1CCN(CC1)CCCC(=O)O.Cl

Computed by PubChem (NCBI)