cas: 214848-28-9 — see every product listed under this CAS number, including other names
Methyl 3-(2-ethoxy-2-oxoethoxy)-4-nitrobenzoate, 95%, 95% (CAS 214848-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11826Z-100mg |
| cas | 214848-28-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(2-ethoxy-2-oxoethoxy)-4-nitrobenzoate (CAS 214848-28-9) is a chemical compound with the molecular formula C12H13NO7 and a molecular weight of 283.23 g/mol. IUPAC name: methyl 3-(2-ethoxy-2-oxoethoxy)-4-nitrobenzoate. InChIKey: HFQWLHPOXJZYHI-UHFFFAOYSA-N.
| Molecular formula | C12H13NO7 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | methyl 3-(2-ethoxy-2-oxoethoxy)-4-nitrobenzoate |
| InChIKey | HFQWLHPOXJZYHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)