Products 812642-72-1

CAS 812642-72-1 is the registry number for 2-(2-Ethoxy-4-formyl-6-nitrophenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid (CAS 812642-72-1) is a chemical compound with the molecular formula C12H13NO7 and a molecular weight of 283.23 g/mol. IUPAC name: 2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid. InChIKey: ZCZIHDVSTSPBPF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO7
Molecular weight283.23 g/mol
IUPAC name2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid
InChIKeyZCZIHDVSTSPBPF-UHFFFAOYSA-N
SMILESCCOC1=CC(=CC(=C1OC(C)C(=O)O)[N+](=O)[O-])C=O

Computed by PubChem (NCBI)