CAS 812642-72-1 is the registry number for 2-(2-Ethoxy-4-formyl-6-nitrophenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid (CAS 812642-72-1) is a chemical compound with the molecular formula C12H13NO7 and a molecular weight of 283.23 g/mol. IUPAC name: 2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid. InChIKey: ZCZIHDVSTSPBPF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO7 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid |
| InChIKey | ZCZIHDVSTSPBPF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1OC(C)C(=O)O)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)