CAS 179419-27-3 appears in our catalog under these names: 2-(((4-Nitrophenoxy)carbonyl)oxy)propan-2-yl acetate, 97%, 1-(Acetyloxy)-1-methylethyl 4-nitrophenyl Ester Carbonic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-(4-nitrophenoxy)carbonyloxypropan-2-yl acetate (CAS 179419-27-3) is a chemical compound with the molecular formula C12H13NO7 and a molecular weight of 283.23 g/mol. IUPAC name: 2-(4-nitrophenoxy)carbonyloxypropan-2-yl acetate. InChIKey: MZLUQGXOSXGRIQ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO7 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)carbonyloxypropan-2-yl acetate |
| InChIKey | MZLUQGXOSXGRIQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)(C)OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)