cas: 1150561-77-5 — see every product listed under this CAS number, including other names
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate 98% (CAS 1150561-77-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143309-250mg |
| cas | 1150561-77-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 1110.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143309 |
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (CAS 1150561-77-5) is a chemical compound with the molecular formula C10H19BO4 and a molecular weight of 214.07 g/mol. IUPAC name: methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate. InChIKey: SWDXLJYTYJQFJI-UHFFFAOYSA-N.
| Molecular formula | C10H19BO4 |
|---|---|
| Molecular weight | 214.07 g/mol |
| IUPAC name | methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| InChIKey | SWDXLJYTYJQFJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(=O)OC |
Computed by PubChem (NCBI)