cas: 1150561-77-5 — see every product listed under this CAS number, including other names
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate, 98%, 98% (CAS 1150561-77-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FSO-250mg |
| cas | 1150561-77-5 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 429.20 Pln | |
| Chemat | 25g | 894.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (CAS 1150561-77-5) is a chemical compound with the molecular formula C10H19BO4 and a molecular weight of 214.07 g/mol. IUPAC name: methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate. InChIKey: SWDXLJYTYJQFJI-UHFFFAOYSA-N.
| Molecular formula | C10H19BO4 |
|---|---|
| Molecular weight | 214.07 g/mol |
| IUPAC name | methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| InChIKey | SWDXLJYTYJQFJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(=O)OC |
Computed by PubChem (NCBI)