cas: 1092460-40-6 — see every product listed under this CAS number, including other names
Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate, >95%, >95% (CAS 1092460-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBCL-100mg |
| cas | 1092460-40-6 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1110.80 Pln | |
| Chemat | 10g | 1662.80 Pln | |
| Chemat | 25g | 3299.60 Pln | |
| Chemat | 100g | 6611.60 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)butanoate (CAS 1092460-40-6) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: methyl 3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)butanoate. InChIKey: XLADYKVTZFVWDT-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | methyl 3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)butanoate |
| InChIKey | XLADYKVTZFVWDT-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC)C1=C(N=CNC1=O)O |
Computed by PubChem (NCBI)