cas: 132067-41-5 — see every product listed under this CAS number, including other names
Methyl 3-(4-bromophenyl)-2-((tert-butoxycarbonyl)amino)propanoate, 98%, 98% (CAS 132067-41-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11215I-100mg |
| cas | 132067-41-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 2008.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 132067-41-5) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: methyl 3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: FDFQRJWLHKSHPZ-UHFFFAOYSA-N.
| Molecular formula | C15H20BrNO4 |
|---|---|
| Molecular weight | 358.23 g/mol |
| IUPAC name | methyl 3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | FDFQRJWLHKSHPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)