CAS 270062-85-6 appears in our catalog under these names: Boc-(s)-3-amino-4-(4-bromo-phenyl)-butyric acid, 95%, Boc-(S)-3-Amino-4-(4-bromo-phenyl)-butyric acid, 98%, 98%, (S)-4-(4-Bromophenyl)-3-((tert-butoxycarbonyl)amino)butanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg.
(3S)-4-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270062-85-6) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: (3S)-4-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: GYXZKHKUVVKDHI-LBPRGKRZSA-N.
| Molecular formula | C15H20BrNO4 |
|---|---|
| Molecular weight | 358.23 g/mol |
| IUPAC name | (3S)-4-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | GYXZKHKUVVKDHI-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)Br)CC(=O)O |
Computed by PubChem (NCBI)