CAS 765263-36-3 appears in our catalog under these names: Boc-(r)-3-amino-4-(2-bromo-phenyl)-butyric acid, 95%, Boc–2–bromo–D–beta–homophenylalanine, Boc-(R)-3-amino-4-(2-bromo-phenyl)-butyric acid, 95%, 95%, Boc-2-bromo-D-b-homophenylalanine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-4-(2-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 765263-36-3) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: (3R)-4-(2-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: MOFCTVVLGCILTN-LLVKDONJSA-N.
| Molecular formula | C15H20BrNO4 |
|---|---|
| Molecular weight | 358.23 g/mol |
| IUPAC name | (3R)-4-(2-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | MOFCTVVLGCILTN-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1Br)CC(=O)O |
Computed by PubChem (NCBI)