Methyl 3-(benzyloxy)benzoate, 98%
cas: 79678-37-8 — see every product listed under this CAS number, including other names
Methyl 3-(benzyloxy)benzoate, 98% (CAS 79678-37-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A645970-250mg |
| cas | 79678-37-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 10g | 587.31 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 403.22 Pln | |
| BLDpharm | 10g | 630.91 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 700.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-phenylmethoxybenzoate (CAS 79678-37-8) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 3-phenylmethoxybenzoate. InChIKey: VQEGUSMZKSIFJC-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 3-phenylmethoxybenzoate |
| InChIKey | VQEGUSMZKSIFJC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)