cas: 260249-10-3 — see every product listed under this CAS number, including other names
Methyl 3-Amino-5-bromo-4-hydroxybenzoate, 96%, 96% (CAS 260249-10-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BI3I-100mg |
| cas | 260249-10-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 3256.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-5-bromo-4-hydroxybenzoate (CAS 260249-10-3) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: methyl 3-amino-5-bromo-4-hydroxybenzoate. InChIKey: GNQMYGQWBUNZBZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | methyl 3-amino-5-bromo-4-hydroxybenzoate |
| InChIKey | GNQMYGQWBUNZBZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)O)N |
Computed by PubChem (NCBI)