cas: 1403483-79-3 — see every product listed under this CAS number, including other names
Methyl 3-Bromo-4-fluoro-5-nitrobenzoate, 96%, 96% (CAS 1403483-79-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WYQ-100mg |
| cas | 1403483-79-3 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 534.80 Pln | |
| Chemat | 10g | 866.00 Pln | |
| Chemat | 25g | 1725.20 Pln | |
| Chemat | 100g | 5790.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-4-fluoro-5-nitrobenzoate (CAS 1403483-79-3) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 3-bromo-4-fluoro-5-nitrobenzoate. InChIKey: JNVZMPJUTRQPPB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 3-bromo-4-fluoro-5-nitrobenzoate |
| InChIKey | JNVZMPJUTRQPPB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)