cas: 1403483-79-3 — see every product listed under this CAS number, including other names
Methyl 3-bromo-4-fluoro-5-nitrobenzoate, 96% (CAS 1403483-79-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F634407-1G |
| cas | 1403483-79-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1528.65 Pln | |
| Fluorochem | 25g | 3408.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-bromo-4-fluoro-5-nitrobenzoate (CAS 1403483-79-3) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 3-bromo-4-fluoro-5-nitrobenzoate. InChIKey: JNVZMPJUTRQPPB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 3-bromo-4-fluoro-5-nitrobenzoate |
| InChIKey | JNVZMPJUTRQPPB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)