Methyl 3-Bromo-5-fluoro-4-nitrobenzoate, 98%
cas: 1123171-93-6 — see every product listed under this CAS number, including other names
Methyl 3-Bromo-5-fluoro-4-nitrobenzoate, 98% (CAS 1123171-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z3K-100mg |
| cas | 1123171-93-6 |
| size | 100mg |
| availability | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3851.60 Pln | |
| Chemat | 50g | 6266.00 Pln | |
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 679.99 Pln | |
| Fluorochem | 5g | 1867.07 Pln | |
| Fluorochem | 10g | 3059.36 Pln | |
| Fluorochem | 25g | 6448.79 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-5-fluoro-4-nitrobenzoate (CAS 1123171-93-6) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 3-bromo-5-fluoro-4-nitrobenzoate. InChIKey: VTKKLEVLDPUKPD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 3-bromo-5-fluoro-4-nitrobenzoate |
| InChIKey | VTKKLEVLDPUKPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)