CAS 1787974-11-1 is the registry number for Methyl 3-amino-1-(propan-2-yl)-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-amino-1-propan-2-ylpyrazole-4-carboxylate (CAS 1787974-11-1) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: methyl 3-amino-1-propan-2-ylpyrazole-4-carboxylate. InChIKey: LRIBTPFJSCYDGM-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | methyl 3-amino-1-propan-2-ylpyrazole-4-carboxylate |
| InChIKey | LRIBTPFJSCYDGM-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=N1)N)C(=O)OC |
Computed by PubChem (NCBI)