CAS 24940-57-6 appears in our catalog under these names: N,N-Dimethyl-his-oh, 95%, (2S)-2-(Dimethylamino)-3-(1H-imidazol-5-yl)propanoic Acid, N,N–Dimethyl–His–OH, N,N-Dimethyl-histidine, N,N-Dimethyl-His-OH, 98%(NMR),RG, 98%(NMR),RG. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 1000mg, 25mg, 5g.
N(alpha),N(alpha)-dimethyl-L-histidine is the Nalpha,Nalpha-dimethyl derivative of L-histidine. It has a role as a fungal metabolite. It is a tautomer of a N(alpha),N(alpha)-dimethyl-L-histidine zwitterion.
Source: ChEBI
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | (2S)-2-(dimethylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | IMOBSLOLPCWZKQ-ZETCQYMHSA-N |
| SMILES | CN(C)[C@@H](CC1=CN=CN1)C(=O)O |
Computed by PubChem (NCBI)