CAS 52094-69-6 appears in our catalog under these names: 8-Methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione, 95%, 8–methyl–1,3,8–triazaspiro(4·5)decane–2,4–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (CAS 52094-69-6) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: 8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione. InChIKey: ZGSNEAYELPMHGT-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| InChIKey | ZGSNEAYELPMHGT-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)