cas: 175137-08-3 — see every product listed under this CAS number, including other names
Methyl 3-amino-5-(4-fluorophenyl)thiophene-2-carboxylate (CAS 175137-08-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008375-1G |
| cas | 175137-08-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1549.47 Pln |
| delivery time | 2-3 weeks |
|---|
Methyl 3-amino-5-(4-fluorophenyl)thiophene-2-carboxylate (CAS 175137-08-3) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: methyl 3-amino-5-(4-fluorophenyl)thiophene-2-carboxylate. InChIKey: YIBRKYVKVWTHEM-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | methyl 3-amino-5-(4-fluorophenyl)thiophene-2-carboxylate |
| InChIKey | YIBRKYVKVWTHEM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)