cas: 750586-06-2 — see every product listed under this CAS number, including other names
Methyl 3-amino-6-bromo-2-methylbenzoate 95% (CAS 750586-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131869-100mg |
| cas | 750586-06-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1393.88 Pln | |
| Ambeed | 5g | 4041.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A131869 |
Methyl 3-amino-6-bromo-2-methylbenzoate (CAS 750586-06-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: methyl 3-amino-6-bromo-2-methylbenzoate. InChIKey: RQAHVOLDFUBDMB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | methyl 3-amino-6-bromo-2-methylbenzoate |
| InChIKey | RQAHVOLDFUBDMB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)OC)Br)N |
Computed by PubChem (NCBI)