cas: 193400-52-1 — see every product listed under this CAS number, including other names
Methyl 3-amino-6-methylthiophene[2,3-b]pyridine-2-carboxylate (CAS 193400-52-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011187-1G |
| cas | 193400-52-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1414.10 Pln | |
| Fluorochem | 10g | 2143.01 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate (CAS 193400-52-1) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: methyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate. InChIKey: HMMFNSAWWIYSJL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | methyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | HMMFNSAWWIYSJL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=C(S2)C(=O)OC)N |
Computed by PubChem (NCBI)