cas: 192945-56-5 — see every product listed under this CAS number, including other names
Methyl 3-bromo-1H-indazole-6-carboxylate, 95% (CAS 192945-56-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F432645-500MG |
| cas | 192945-56-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 143.72 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1320.39 Pln | |
| Fluorochem | 100g | 5105.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-bromo-2H-indazole-6-carboxylate (CAS 192945-56-5) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 3-bromo-2H-indazole-6-carboxylate. InChIKey: NXMJEXMODINMIJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 3-bromo-2H-indazole-6-carboxylate |
| InChIKey | NXMJEXMODINMIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NNC(=C2C=C1)Br |
Computed by PubChem (NCBI)