Methyl 3-bromo-2-fluoro-6-iodobenzoate, 97%
cas: 1936253-89-2 — see every product listed under this CAS number, including other names
Methyl 3-bromo-2-fluoro-6-iodobenzoate, 97% (CAS 1936253-89-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A124958-250mg |
| cas | 1936253-89-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 2289.44 Pln | |
| Ambeed | 25g | 7612.75 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 2458.05 Pln | |
| BLDpharm | 25g | 8200.47 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2474.00 Pln | |
| Chemat | 25g | 4888.40 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 2356.48 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-bromo-2-fluoro-6-iodobenzoate (CAS 1936253-89-2) is a chemical compound with the molecular formula C8H5BrFIO2 and a molecular weight of 358.93 g/mol. IUPAC name: methyl 3-bromo-2-fluoro-6-iodobenzoate. InChIKey: FYRSGGGTNFARPF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFIO2 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | methyl 3-bromo-2-fluoro-6-iodobenzoate |
| InChIKey | FYRSGGGTNFARPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)I |
Computed by PubChem (NCBI)
Synonyms:
Methyl 3-bromo-2-fluoro-6-iodobenzoate, Benzoic acid,3-bromo-2-fluoro-6-iodo-,methyl ester, methyl3-bromo-2-fluoro-6-iodobenzoate, Benzoic acid, 3-bromo-2-fluoro-6-iodo-, methyl ester, methyl 3-bromo-2-fluoro-6-iodo-benzoate, Benzoicacid,3-bromo-2-fluoro-6-iodo-,methylester, Benzoic acid,3-bromo-2-fluoro-6-iodo-,methyl esterWS205024