CAS 1626409-45-7 is the registry number for 5-Bromo-2-fluoro-4-iodo-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 5-bromo-2-fluoro-4-iodobenzoate (CAS 1626409-45-7) is a chemical compound with the molecular formula C8H5BrFIO2 and a molecular weight of 358.93 g/mol. IUPAC name: methyl 5-bromo-2-fluoro-4-iodobenzoate. InChIKey: BQNADONQXRVNKK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFIO2 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | methyl 5-bromo-2-fluoro-4-iodobenzoate |
| InChIKey | BQNADONQXRVNKK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)I)Br |
Computed by PubChem (NCBI)