Products 1509454-55-0
CAS 1509454-55-0 is the registry number for Methyl 4-bromo-2-fluoro-5-iodobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-bromo-2-fluoro-5-iodobenzoate (CAS 1509454-55-0) is a chemical compound with the molecular formula C8H5BrFIO2 and a molecular weight of 358.93 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-5-iodobenzoate. InChIKey: YXPVEGSJHNQEIT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFIO2 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-5-iodobenzoate |
| InChIKey | YXPVEGSJHNQEIT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)Br)I |
Computed by PubChem (NCBI)