cas: 1214337-00-4 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-fluoropicolinate, 96%, 96% (CAS 1214337-00-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125TS-100mg |
| cas | 1214337-00-4 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 500mg | 342.80 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1091.60 Pln | |
| Chemat | 10g | 1883.60 Pln | |
| Chemat | 25g | 3669.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-5-fluoropyridine-2-carboxylate (CAS 1214337-00-4) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: methyl 3-bromo-5-fluoropyridine-2-carboxylate. InChIKey: BXVIPHUMAZBNSW-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | methyl 3-bromo-5-fluoropyridine-2-carboxylate |
| InChIKey | BXVIPHUMAZBNSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)F)Br |
Computed by PubChem (NCBI)