Methyl 3-bromo-5-isobutoxybenzoate, 97%
cas: 1255574-35-6 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-isobutoxybenzoate, 97% (CAS 1255574-35-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 10g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-5083-1g |
| cas | 1255574-35-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 960.00 Pln | |
| Ambeed | 10g | 1610.81 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1067.60 Pln | |
| Chemat | 10g | 1614.80 Pln | |
| Chemat | 25g | 3179.60 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 392.11 Pln | |
| BLDpharm | 5g | 1030.77 Pln | |
| BLDpharm | 10g | 1730.53 Pln | |
| BLDpharm | 25g | 2946.76 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 1976.41 Pln | |
| Fluorochem | 25g | 5896.90 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 3-bromo-5-(2-methylpropoxy)benzoate (CAS 1255574-35-6) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: methyl 3-bromo-5-(2-methylpropoxy)benzoate. InChIKey: ILWDNEOAPBNDPA-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | methyl 3-bromo-5-(2-methylpropoxy)benzoate |
| InChIKey | ILWDNEOAPBNDPA-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC(=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)