Products 1820640-94-5

CAS 1820640-94-5 is the registry number for methyl 4-bromo-2-butoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2-butoxybenzoate (CAS 1820640-94-5) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: methyl 4-bromo-2-butoxybenzoate. InChIKey: MOZGSDXONNYCGP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrO3
Molecular weight287.15 g/mol
IUPAC namemethyl 4-bromo-2-butoxybenzoate
InChIKeyMOZGSDXONNYCGP-UHFFFAOYSA-N
SMILESCCCCOC1=C(C=CC(=C1)Br)C(=O)OC

Computed by PubChem (NCBI)