Products 938341-40-3
CAS 938341-40-3 is the registry number for 3-(4-Bromo-3-methylphenoxy)-2,2-dimethylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-bromo-3-methylphenoxy)-2,2-dimethylpropanoic acid (CAS 938341-40-3) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: 3-(4-bromo-3-methylphenoxy)-2,2-dimethylpropanoic acid. InChIKey: DFCLPRTZRUNRBX-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 3-(4-bromo-3-methylphenoxy)-2,2-dimethylpropanoic acid |
| InChIKey | DFCLPRTZRUNRBX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(C)(C)C(=O)O)Br |
Computed by PubChem (NCBI)