cas: 443144-24-9 — see every product listed under this CAS number, including other names
Methyl 3-cyano-1H-indole-7-carboxylate, 98% (CAS 443144-24-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091567-250MG |
| cas | 443144-24-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 1158.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-cyano-1H-indole-7-carboxylate (CAS 443144-24-9) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: methyl 3-cyano-1H-indole-7-carboxylate. InChIKey: GXGCVEVNRZWNRA-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | methyl 3-cyano-1H-indole-7-carboxylate |
| InChIKey | GXGCVEVNRZWNRA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1NC=C2C#N |
Computed by PubChem (NCBI)