cas: 1215074-49-9 — see every product listed under this CAS number, including other names
Methyl 3-fluoro-4-(methylsulfonyl)benzoate (CAS 1215074-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F378094-1G |
| cas | 1215074-49-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1070.47 Pln | |
| Fluorochem | 5g | 3168.69 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-fluoro-4-methylsulfonylbenzoate (CAS 1215074-49-9) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: methyl 3-fluoro-4-methylsulfonylbenzoate. InChIKey: ACDGZYOVJKPTRE-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | methyl 3-fluoro-4-methylsulfonylbenzoate |
| InChIKey | ACDGZYOVJKPTRE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)S(=O)(=O)C)F |
Computed by PubChem (NCBI)