cas: 13305-16-3 — see every product listed under this CAS number, including other names
Methyl 3-hydroxy-3-(4-methoxyphenyl)propanoate, 98% (CAS 13305-16-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1940382-5g |
| cas | 13305-16-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 20381.20 Pln | |
| AmBeed | 10g | 35614.60 Pln | |
| Fluorochem | 100mg | 1054.85 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 500mg | 3382.16 Pln | |
| Fluorochem | 1g | 4397.43 Pln | |
| Fluorochem | 2.5g | 8573.04 Pln | |
| Fluorochem | 5g | 12831.96 Pln | |
| Fluorochem | 10g | 22411.92 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-hydroxy-3-(4-methoxyphenyl)propanoate (CAS 13305-16-3) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: methyl 3-hydroxy-3-(4-methoxyphenyl)propanoate. InChIKey: SLSMILXGFSQOHY-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 3-hydroxy-3-(4-methoxyphenyl)propanoate |
| InChIKey | SLSMILXGFSQOHY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CC(=O)OC)O |
Computed by PubChem (NCBI)