cas: 2026647-81-2 — see every product listed under this CAS number, including other names
Methyl 3-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 96% (CAS 2026647-81-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A818332-5g |
| cas | 2026647-81-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8253.07 Pln | |
| Fluorochem | 100mg | 877.83 Pln | |
| Fluorochem | 250mg | 1221.46 Pln | |
| Fluorochem | 1g | 2939.61 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2026647-81-2) is a chemical compound with the molecular formula C14H19BO5 and a molecular weight of 278.11 g/mol. IUPAC name: methyl 3-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VNTDZKJUUCGKNB-UHFFFAOYSA-N.
| Molecular formula | C14H19BO5 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | methyl 3-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VNTDZKJUUCGKNB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC)O |
Computed by PubChem (NCBI)