cas: 89901-03-1 — see every product listed under this CAS number, including other names
Methyl 4'-bromobiphenyl-4-carboxylate, 95% (CAS 89901-03-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620732-5G |
| cas | 89901-03-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1221.46 Pln | |
| Fluorochem | 25g | 2465.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-(4-bromophenyl)benzoate (CAS 89901-03-1) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: methyl 4-(4-bromophenyl)benzoate. InChIKey: JHNMJLKCONRGMK-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | methyl 4-(4-bromophenyl)benzoate |
| InChIKey | JHNMJLKCONRGMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)