cas: 10540-38-2 — see every product listed under this CAS number, including other names
Methyl 4'-fluoro-[1,1'-biphenyl]-3-carboxylate, 98% (CAS 10540-38-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F553762-100MG |
| cas | 10540-38-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 1778.56 Pln | |
| Fluorochem | 1g | 3481.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-(4-fluorophenyl)benzoate (CAS 10540-38-2) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)benzoate. InChIKey: LICRACFKWCQWBK-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)benzoate |
| InChIKey | LICRACFKWCQWBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)