CAS 10540-38-2 appears in our catalog under these names: Methyl 4'-fluoro[1,1'-biphenyl]-3-carboxylate, 95%, Methyl 4'-fluoro[1,1'-biphenyl]-3-carboxylate, 98%, 98%, Methyl 4'-fluoro-[1,1'-biphenyl]-3-carboxylate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 3-(4-fluorophenyl)benzoate (CAS 10540-38-2) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)benzoate. InChIKey: LICRACFKWCQWBK-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)benzoate |
| InChIKey | LICRACFKWCQWBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)