cas: 1198-71-6 — see every product listed under this CAS number, including other names
Methyl 4,5-dibromo-1-methyl-1H-pyrrole-2-carboxylate, 97% (CAS 1198-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F766862-100MG |
| cas | 1198-71-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3715.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4,5-dibromo-1-methylpyrrole-2-carboxylate (CAS 1198-71-6) is a chemical compound with the molecular formula C7H7Br2NO2 and a molecular weight of 296.94 g/mol. IUPAC name: methyl 4,5-dibromo-1-methylpyrrole-2-carboxylate. InChIKey: UTOZAUBXQWRZIF-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2 |
|---|---|
| Molecular weight | 296.94 g/mol |
| IUPAC name | methyl 4,5-dibromo-1-methylpyrrole-2-carboxylate |
| InChIKey | UTOZAUBXQWRZIF-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=C1Br)Br)C(=O)OC |
Computed by PubChem (NCBI)