cas: 96232-70-1 — see every product listed under this CAS number, including other names
Methyl 4,5-dichloro-3-hydroxythiophene-2-carboxylate, 98%, 98% (CAS 96232-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116VBZ-100mg |
| cas | 96232-70-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 875.60 Pln | |
| Chemat | 5g | 2958.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4,5-dichloro-3-hydroxythiophene-2-carboxylate (CAS 96232-70-1) is a chemical compound with the molecular formula C6H4Cl2O3S and a molecular weight of 227.06 g/mol. IUPAC name: methyl 4,5-dichloro-3-hydroxythiophene-2-carboxylate. InChIKey: OKYOKWYLOLTNFT-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O3S |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | methyl 4,5-dichloro-3-hydroxythiophene-2-carboxylate |
| InChIKey | OKYOKWYLOLTNFT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(S1)Cl)Cl)O |
Computed by PubChem (NCBI)