CAS 120715-49-3 appears in our catalog under these names: 4,5–Dichloro–3–methoxythiophene–2–carboxylic acid, 4,5-Dichloro-3-methoxythiophene-2-carboxylic acid, 4,5-Dichloro-3-methoxythiophene-2-carboxylic acid, 97%, 4,5-Dichloro-3-methoxythiophene-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
4,5-dichloro-3-methoxythiophene-2-carboxylic acid (CAS 120715-49-3) is a chemical compound with the molecular formula C6H4Cl2O3S and a molecular weight of 227.06 g/mol. IUPAC name: 4,5-dichloro-3-methoxythiophene-2-carboxylic acid. InChIKey: GSUFOPYPKUVCQB-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O3S |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 4,5-dichloro-3-methoxythiophene-2-carboxylic acid |
| InChIKey | GSUFOPYPKUVCQB-UHFFFAOYSA-N |
| SMILES | COC1=C(SC(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)