CAS 88-42-6 appears in our catalog under these names: 2,5-Dichlorobenzenesulfonic acid, 98%, 2,5–Dichlorobenzenesulfonic Acid Dihydrate, 2,5-Dichlorobenzenesulfonic Acid Dihydrate, >98.0%(HPLC)(T), 2,5-Dichlorobenzenesulfonic acid, 2,5-Dichlorobenzene sulfonic acid hydrate, 99%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g.
2,5-dichlorobenzenesulfonic acid (CAS 88-42-6) is a chemical compound with the molecular formula C6H4Cl2O3S and a molecular weight of 227.06 g/mol. IUPAC name: 2,5-dichlorobenzenesulfonic acid. InChIKey: LFXZSGVZSSMCMB-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O3S |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 2,5-dichlorobenzenesulfonic acid |
| InChIKey | LFXZSGVZSSMCMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)