Products 88-42-6

CAS 88-42-6 appears in our catalog under these names: 2,5-Dichlorobenzenesulfonic acid, 98%, 2,5–Dichlorobenzenesulfonic Acid Dihydrate, 2,5-Dichlorobenzenesulfonic Acid Dihydrate, >98.0%(HPLC)(T), 2,5-Dichlorobenzenesulfonic acid, 2,5-Dichlorobenzene sulfonic acid hydrate, 99%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2,5-dichlorobenzenesulfonic acid (CAS 88-42-6) is a chemical compound with the molecular formula C6H4Cl2O3S and a molecular weight of 227.06 g/mol. IUPAC name: 2,5-dichlorobenzenesulfonic acid. InChIKey: LFXZSGVZSSMCMB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl2O3S
Molecular weight227.06 g/mol
IUPAC name2,5-dichlorobenzenesulfonic acid
InChIKeyLFXZSGVZSSMCMB-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)S(=O)(=O)O)Cl

Computed by PubChem (NCBI)