cas: 30913-86-1 — see every product listed under this CAS number, including other names
Methyl 4-(4-bromophenyl)-4-oxobutanoate, 98% (CAS 30913-86-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033512-1G |
| cas | 30913-86-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 10g | 1346.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(4-bromophenyl)-4-oxobutanoate (CAS 30913-86-1) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: methyl 4-(4-bromophenyl)-4-oxobutanoate. InChIKey: NSIXBKXISVRTCO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | methyl 4-(4-bromophenyl)-4-oxobutanoate |
| InChIKey | NSIXBKXISVRTCO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)