cas: 39757-31-8 — see every product listed under this CAS number, including other names
Methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate 95% (CAS 39757-31-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A599497-1g |
| cas | 39757-31-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Ambeed | 25g | 5677.00 Pln | |
| Ambeed | 100g | 20484.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A599497 |
Methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate (CAS 39757-31-8) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: RSKKVNLCWKPWEI-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | RSKKVNLCWKPWEI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)