Products 848052-89-1
CAS 848052-89-1 appears in our catalog under these names: Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate, 95%, Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate, Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate, 97%, 97%, methyl 2-hydroxy-4-(2-methoxyphenyl)-4-oxobut-2-enoate, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g, 50mg, 100mg, 500mg.
Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate (CAS 848052-89-1) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: JCPJQSOTWWRUKR-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | JCPJQSOTWWRUKR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)