CAS 39757-31-8 appears in our catalog under these names: Methyl (2Z)-2-hydroxy-4-(4-methoxyphenyl)-4-oxobut-2-enoate, 97%, Methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate, 98%, Methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate 95%, Methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate (CAS 39757-31-8) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: RSKKVNLCWKPWEI-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl 4-(4-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | RSKKVNLCWKPWEI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)