cas: 167482-99-7 — see every product listed under this CAS number, including other names
Methyl 4-(di(1H-pyrrol-2-yl)methyl)benzoate, 96% (CAS 167482-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F770658-100MG |
| cas | 167482-99-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 1g | 2070.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-[bis(1H-pyrrol-2-yl)methyl]benzoate (CAS 167482-99-7) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: methyl 4-[bis(1H-pyrrol-2-yl)methyl]benzoate. InChIKey: IMQPCUGJFLINEV-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | methyl 4-[bis(1H-pyrrol-2-yl)methyl]benzoate |
| InChIKey | IMQPCUGJFLINEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(C2=CC=CN2)C3=CC=CN3 |
Computed by PubChem (NCBI)