cas: 1192547-87-7 — see every product listed under this CAS number, including other names
Methyl 4-Chloro-3,5-Dimethylbenzoate, 98%, 98% (CAS 1192547-87-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P7K-100mg |
| cas | 1192547-87-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 146.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloro-3,5-dimethylbenzoate (CAS 1192547-87-7) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 4-chloro-3,5-dimethylbenzoate. InChIKey: YLDCLGVDBHWQBX-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | methyl 4-chloro-3,5-dimethylbenzoate |
| InChIKey | YLDCLGVDBHWQBX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)C(=O)OC |
Computed by PubChem (NCBI)